C13H5Cl3FNS — CID 50850082
6-fluoro-2-(3,4,5-trichlorophenyl)-1,3-benzothiazole (PubChem CID 50850082) has the molecular formula C13H5Cl3FNS and a molecular weight of 332.61 g/mol. Its IUPAC name is 6-fluoro-2-(3,4,5-trichlorophenyl)-1,3-benzothiazole.
| Compound Name | 6-fluoro-2-(3,4,5-trichlorophenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 50850082 |
| Molecular Formula | C13H5Cl3FNS |
| Molecular Weight | 332.61 g/mol |
| Exact Mass | 330.92 |
| IUPAC Name | 6-fluoro-2-(3,4,5-trichlorophenyl)-1,3-benzothiazole |
| SMILES | Fc1ccc2nc(-c3cc(Cl)c(Cl)c(Cl)c3)sc2c1 |
| InChI | InChI=1S/C13H5Cl3FNS/c14-8-3-6(4-9(15)12(8)16)13-18-10-2-1-7(17)5-11(10)19-13/h1-5H |
| InChIKey | ZAHJKCBFFDBVKA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|