C14H10FN3OS — CID 50850273
4-(6-fluoro-1,3-benzothiazol-2-yl)benzohydrazide (PubChem CID 50850273) has the molecular formula C14H10FN3OS and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-(6-fluoro-1,3-benzothiazol-2-yl)benzohydrazide.
| Compound Name | 4-(6-fluoro-1,3-benzothiazol-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 50850273 |
| Molecular Formula | C14H10FN3OS |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 4-(6-fluoro-1,3-benzothiazol-2-yl)benzohydrazide |
| SMILES | NNC(=O)c1ccc(-c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C14H10FN3OS/c15-10-5-6-11-12(7-10)20-14(17-11)9-3-1-8(2-4-9)13(19)18-16/h1-7H,16H2,(H,18,19) |
| InChIKey | GLTYNIHSWXLYQE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|