C13H7FN2O2S — CID 10588362
6-fluoro-2-(4-nitrophenyl)-1,3-benzothiazole (PubChem CID 10588362) has the molecular formula C13H7FN2O2S and a molecular weight of 274.28 g/mol. Its IUPAC name is 6-fluoro-2-(4-nitrophenyl)-1,3-benzothiazole.
| Compound Name | 6-fluoro-2-(4-nitrophenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 10588362 |
| Molecular Formula | C13H7FN2O2S |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 6-fluoro-2-(4-nitrophenyl)-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C13H7FN2O2S/c14-9-3-6-11-12(7-9)19-13(15-11)8-1-4-10(5-2-8)16(17)18/h1-7H |
| InChIKey | UYFDMHRGUWCUHK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|