About 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole
6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole (PubChem CID 46232051) has the molecular formula C16H12N4O2S
and a molecular weight of 324.37 g/mol. Its IUPAC name is 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole |
| PubChem CID | 46232051 |
| Molecular Formula | C16H12N4O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3ccc(C4=NCCN4)cc3s2)cc1 |
| InChI | InChI=1S/C16H12N4O2S/c21-20(22)12-4-1-10(2-5-12)16-19-13-6-3-11(9-14(13)23-16)15-17-7-8-18-15/h1-6,9H,7-8H2,(H,17,18) |
| InChIKey | PVBWSUCVFQCRPT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole?
The IUPAC name of 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole (CID 46232051) is 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole.
What is the SMILES notation for 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole?
The canonical SMILES for 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole is O=[N+]([O-])c1ccc(-c2nc3ccc(C4=NCCN4)cc3s2)cc1.
What is the InChIKey of 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole?
The InChIKey is PVBWSUCVFQCRPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O2S/c21-20(22)12-4-1-10(2-5-12)16-19-13-6-3-11(9-14(13)23-16)15-17-7-8-18-15/h1-6,9H,7-8H2,(H,17,18).
What are the key properties of 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole?
6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole has a molecular weight of 324.37 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-nitrophenyl)-1,3-benzothiazole is sourced from PubChem (CID 46232051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).