C13H8N2O3S — CID 162639439
2-(6-nitro-1,3-benzothiazol-2-yl)phenol (PubChem CID 162639439) has the molecular formula C13H8N2O3S and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-(6-nitro-1,3-benzothiazol-2-yl)phenol.
| Compound Name | 2-(6-nitro-1,3-benzothiazol-2-yl)phenol |
|---|---|
| PubChem CID | 162639439 |
| Molecular Formula | C13H8N2O3S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2-(6-nitro-1,3-benzothiazol-2-yl)phenol |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3ccccc3O)sc2c1 |
| InChI | InChI=1S/C13H8N2O3S/c16-11-4-2-1-3-9(11)13-14-10-6-5-8(15(17)18)7-12(10)19-13/h1-7,16H |
| InChIKey | FTSCJKZKJRDECS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|