C17H10N4O2S — CID 101494217
azulen-1-yl-(6-nitro-1,3-benzothiazol-2-yl)diazene (PubChem CID 101494217) has the molecular formula C17H10N4O2S and a molecular weight of 334.36 g/mol. Its IUPAC name is azulen-1-yl-(6-nitro-1,3-benzothiazol-2-yl)diazene.
| Compound Name | azulen-1-yl-(6-nitro-1,3-benzothiazol-2-yl)diazene |
|---|---|
| PubChem CID | 101494217 |
| Molecular Formula | C17H10N4O2S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | azulen-1-yl-(6-nitro-1,3-benzothiazol-2-yl)diazene |
| SMILES | O=[N+]([O-])c1ccc2nc(/N=N/c3ccc4cccccc3-4)sc2c1 |
| InChI | InChI=1S/C17H10N4O2S/c22-21(23)12-7-9-15-16(10-12)24-17(18-15)20-19-14-8-6-11-4-2-1-3-5-13(11)14/h1-10H/b20-19+ |
| InChIKey | RKARJPFABMNDDU-FMQUCBEESA-N |
| XLogP | 5.72 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|