About 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol
5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol (PubChem CID 136912409) has the molecular formula C16H9N5O3S
and a molecular weight of 351.35 g/mol. Its IUPAC name is 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol.
Molecular Properties
| Compound Name | 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol |
| PubChem CID | 136912409 |
| Molecular Formula | C16H9N5O3S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol |
| SMILES | O=[N+]([O-])c1ccc2sc(/N=N/c3ccc(O)c4ncccc34)nc2c1 |
| InChI | InChI=1S/C16H9N5O3S/c22-13-5-4-11(10-2-1-7-17-15(10)13)19-20-16-18-12-8-9(21(23)24)3-6-14(12)25-16/h1-8,22H/b20-19+ |
| InChIKey | NGZJCPLYOMBGTB-FMQUCBEESA-N |
| XLogP | 4.87 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol?
The IUPAC name of 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol (CID 136912409) is 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol.
What is the SMILES notation for 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol?
The canonical SMILES for 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol is O=[N+]([O-])c1ccc2sc(/N=N/c3ccc(O)c4ncccc34)nc2c1.
What is the InChIKey of 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol?
The InChIKey is NGZJCPLYOMBGTB-FMQUCBEESA-N. The full InChI is InChI=1S/C16H9N5O3S/c22-13-5-4-11(10-2-1-7-17-15(10)13)19-20-16-18-12-8-9(21(23)24)3-6-14(12)25-16/h1-8,22H/b20-19+.
What are the key properties of 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol?
5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol has a molecular weight of 351.35 g/mol, XLogP of 4.87, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-nitro-1,3-benzothiazol-2-yl)diazenyl]quinolin-8-ol is sourced from PubChem (CID 136912409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).