C16H9N7O4 — CID 71326871
2-[(8-aminoquinolin-5-yl)diazenyl]-3,5-dinitrobenzonitrile (PubChem CID 71326871) has the molecular formula C16H9N7O4 and a molecular weight of 363.29 g/mol. Its IUPAC name is 2-[(8-aminoquinolin-5-yl)diazenyl]-3,5-dinitrobenzonitrile.
| Compound Name | 2-[(8-aminoquinolin-5-yl)diazenyl]-3,5-dinitrobenzonitrile |
|---|---|
| PubChem CID | 71326871 |
| Molecular Formula | C16H9N7O4 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-[(8-aminoquinolin-5-yl)diazenyl]-3,5-dinitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1/N=N/c1ccc(N)c2ncccc12 |
| InChI | InChI=1S/C16H9N7O4/c17-8-9-6-10(22(24)25)7-14(23(26)27)15(9)21-20-13-4-3-12(18)16-11(13)2-1-5-19-16/h1-7H,18H2/b21-20+ |
| InChIKey | YGGANXRNVIESMA-QZQOTICOSA-N |
| XLogP | 3.92 |
| TPSA | 173.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|