C21H21N7O5 — CID 88777406
N-[2-[(2-cyano-4,6-dinitrophenyl)diazenyl]-5-(cyclohexylamino)phenyl]acetamide (PubChem CID 88777406) has the molecular formula C21H21N7O5 and a molecular weight of 451.44 g/mol. Its IUPAC name is N-[2-[(2-cyano-4,6-dinitrophenyl)diazenyl]-5-(cyclohexylamino)phenyl]acetamide.
| Compound Name | N-[2-[(2-cyano-4,6-dinitrophenyl)diazenyl]-5-(cyclohexylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 88777406 |
| Molecular Formula | C21H21N7O5 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | N-[2-[(2-cyano-4,6-dinitrophenyl)diazenyl]-5-(cyclohexylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(NC2CCCCC2)ccc1/N=N/c1c(C#N)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21N7O5/c1-13(29)23-19-10-16(24-15-5-3-2-4-6-15)7-8-18(19)25-26-21-14(12-22)9-17(27(30)31)11-20(21)28(32)33/h7-11,15,24H,2-6H2,1H3,(H,23,29)/b26-25+ |
| InChIKey | OCOQVELCGYZCKA-OCEACIFDSA-N |
| XLogP | 5.49 |
| TPSA | 175.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|