C16H11N7O3 — CID 71385265
N-[5-amino-2-[(2,6-dicyano-4-nitrophenyl)diazenyl]phenyl]acetamide (PubChem CID 71385265) has the molecular formula C16H11N7O3 and a molecular weight of 349.31 g/mol. Its IUPAC name is N-[5-amino-2-[(2,6-dicyano-4-nitrophenyl)diazenyl]phenyl]acetamide.
| Compound Name | N-[5-amino-2-[(2,6-dicyano-4-nitrophenyl)diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 71385265 |
| Molecular Formula | C16H11N7O3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[5-amino-2-[(2,6-dicyano-4-nitrophenyl)diazenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(N)ccc1/N=N/c1c(C#N)cc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C16H11N7O3/c1-9(24)20-15-6-12(19)2-3-14(15)21-22-16-10(7-17)4-13(23(25)26)5-11(16)8-18/h2-6H,19H2,1H3,(H,20,24)/b22-21+ |
| InChIKey | JCICWLMXCXDINO-QURGRASLSA-N |
| XLogP | 3.29 |
| TPSA | 170.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|