C29H28N6O5 — CID 164991005
2-methylprop-2-enyl 3-[3-acetamido-N-benzyl-4-[(2-cyano-4-nitrophenyl)diazenyl]anilino]propanoate (PubChem CID 164991005) has the molecular formula C29H28N6O5 and a molecular weight of 540.58 g/mol. Its IUPAC name is 2-methylprop-2-enyl 3-[3-acetamido-N-benzyl-4-[(2-cyano-4-nitrophenyl)diazenyl]anilino]propanoate.
| Compound Name | 2-methylprop-2-enyl 3-[3-acetamido-N-benzyl-4-[(2-cyano-4-nitrophenyl)diazenyl]anilino]propanoate |
|---|---|
| PubChem CID | 164991005 |
| Molecular Formula | C29H28N6O5 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 2-methylprop-2-enyl 3-[3-acetamido-N-benzyl-4-[(2-cyano-4-nitrophenyl)diazenyl]anilino]propanoate |
| SMILES | C=C(C)COC(=O)CCN(Cc1ccccc1)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2C#N)c(NC(C)=O)c1 |
| InChI | InChI=1S/C29H28N6O5/c1-20(2)19-40-29(37)13-14-34(18-22-7-5-4-6-8-22)24-9-12-27(28(16-24)31-21(3)36)33-32-26-11-10-25(35(38)39)15-23(26)17-30/h4-12,15-16H,1,13-14,18-19H2,2-3H3,(H,31,36)/b33-32+ |
| InChIKey | HFMUQDOAHZEEEC-ULIFNZDWSA-N |
| XLogP | 6.36 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|