C23H27N5O8 — CID 135772761
2-[3-acetamido-N-(2-acetyloxyethyl)-4-[(2-hydroxy-4-nitrophenyl)diazenyl]anilino]ethyl propanoate (PubChem CID 135772761) has the molecular formula C23H27N5O8 and a molecular weight of 501.50 g/mol. Its IUPAC name is 2-[3-acetamido-N-(2-acetyloxyethyl)-4-[(2-hydroxy-4-nitrophenyl)diazenyl]anilino]ethyl propanoate.
| Compound Name | 2-[3-acetamido-N-(2-acetyloxyethyl)-4-[(2-hydroxy-4-nitrophenyl)diazenyl]anilino]ethyl propanoate |
|---|---|
| PubChem CID | 135772761 |
| Molecular Formula | C23H27N5O8 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 2-[3-acetamido-N-(2-acetyloxyethyl)-4-[(2-hydroxy-4-nitrophenyl)diazenyl]anilino]ethyl propanoate |
| SMILES | CCC(=O)OCCN(CCOC(C)=O)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2O)c(NC(C)=O)c1 |
| InChI | InChI=1S/C23H27N5O8/c1-4-23(32)36-12-10-27(9-11-35-16(3)30)17-5-7-19(21(13-17)24-15(2)29)25-26-20-8-6-18(28(33)34)14-22(20)31/h5-8,13-14,31H,4,9-12H2,1-3H3,(H,24,29)/b26-25+ |
| InChIKey | KOECTBHTOUSXNO-OCEACIFDSA-N |
| XLogP | 4.00 |
| TPSA | 173.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|