C25H36N4O4 — CID 163433155
5-(dihexylamino)-2-[(2-methoxy-4-nitrophenyl)diazenyl]phenol (PubChem CID 163433155) has the molecular formula C25H36N4O4 and a molecular weight of 456.59 g/mol. Its IUPAC name is 5-(dihexylamino)-2-[(2-methoxy-4-nitrophenyl)diazenyl]phenol.
| Compound Name | 5-(dihexylamino)-2-[(2-methoxy-4-nitrophenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 163433155 |
| Molecular Formula | C25H36N4O4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 5-(dihexylamino)-2-[(2-methoxy-4-nitrophenyl)diazenyl]phenol |
| SMILES | CCCCCCN(CCCCCC)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2OC)c(O)c1 |
| InChI | InChI=1S/C25H36N4O4/c1-4-6-8-10-16-28(17-11-9-7-5-2)20-12-14-22(24(30)18-20)26-27-23-15-13-21(29(31)32)19-25(23)33-3/h12-15,18-19,30H,4-11,16-17H2,1-3H3/b27-26+ |
| InChIKey | NKCXMHMWYDUCMY-CYYJNZCTSA-N |
| XLogP | 7.69 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|