C43H58N6O8-2 — CID 131741528
4-[4-(3-carboxylatopropoxy)-5-[[4-(dioctylamino)-2-methylphenyl]diazenyl]-2-[(4-nitrophenyl)diazenyl]phenoxy]butanoate (PubChem CID 131741528) has the molecular formula C43H58N6O8-2 and a molecular weight of 786.97 g/mol. Its IUPAC name is 4-[4-(3-carboxylatopropoxy)-5-[[4-(dioctylamino)-2-methylphenyl]diazenyl]-2-[(4-nitrophenyl)diazenyl]phenoxy]butanoate.
| Compound Name | 4-[4-(3-carboxylatopropoxy)-5-[[4-(dioctylamino)-2-methylphenyl]diazenyl]-2-[(4-nitrophenyl)diazenyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 131741528 |
| Molecular Formula | C43H58N6O8-2 |
| Molecular Weight | 786.97 g/mol |
| Exact Mass | 786.43 |
| IUPAC Name | 4-[4-(3-carboxylatopropoxy)-5-[[4-(dioctylamino)-2-methylphenyl]diazenyl]-2-[(4-nitrophenyl)diazenyl]phenoxy]butanoate |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc(/N=N/c2cc(OCCCC(=O)[O-])c(/N=N/c3ccc([N+](=O)[O-])cc3)cc2OCCCC(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C43H60N6O8/c1-4-6-8-10-12-14-26-48(27-15-13-11-9-7-5-2)36-24-25-37(33(3)30-36)45-47-39-32-40(56-28-16-18-42(50)51)38(31-41(39)57-29-17-19-43(52)53)46-44-34-20-22-35(23-21-34)49(54)55/h20-25,30-32H,4-19,26-29H2,1-3H3,(H,50,51)(H,52,53)/p-2/b46-44+,47-45+ |
| InChIKey | UHCOSEBIWYGSCL-NFAUJPPVSA-L |
| XLogP | 10.08 |
| TPSA | 194.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.97 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|