C38H54N6O5 — CID 123571359
2-[5-[[4-[heptyl(octyl)amino]-2-methylphenyl]diazenyl]-4-(2-hydroxyethoxy)-2-[(4-nitrosophenyl)diazenyl]phenoxy]ethanol (PubChem CID 123571359) has the molecular formula C38H54N6O5 and a molecular weight of 674.89 g/mol. Its IUPAC name is 2-[5-[[4-[heptyl(octyl)amino]-2-methylphenyl]diazenyl]-4-(2-hydroxyethoxy)-2-[(4-nitrosophenyl)diazenyl]phenoxy]ethanol.
| Compound Name | 2-[5-[[4-[heptyl(octyl)amino]-2-methylphenyl]diazenyl]-4-(2-hydroxyethoxy)-2-[(4-nitrosophenyl)diazenyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 123571359 |
| Molecular Formula | C38H54N6O5 |
| Molecular Weight | 674.89 g/mol |
| Exact Mass | 674.42 |
| IUPAC Name | 2-[5-[[4-[heptyl(octyl)amino]-2-methylphenyl]diazenyl]-4-(2-hydroxyethoxy)-2-[(4-nitrosophenyl)diazenyl]phenoxy]ethanol |
| SMILES | CCCCCCCCN(CCCCCCC)c1ccc(/N=N/c2cc(OCCO)c(/N=N/c3ccc(N=O)cc3)cc2OCCO)c(C)c1 |
| InChI | InChI=1S/C38H54N6O5/c1-4-6-8-10-12-14-22-44(21-13-11-9-7-5-2)33-19-20-34(30(3)27-33)40-42-36-29-37(48-25-23-45)35(28-38(36)49-26-24-46)41-39-31-15-17-32(43-47)18-16-31/h15-20,27-29,45-46H,4-14,21-26H2,1-3H3/b41-39+,42-40+ |
| InChIKey | WZNMWXVHBLJBHN-LMXNTIJMSA-N |
| XLogP | 11.10 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.89 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|