C32H43N5O2 — CID 135225069
2-[N-decyl-4-[(2-methoxy-5-methyl-4-phenyldiazenylphenyl)diazenyl]anilino]ethanol (PubChem CID 135225069) has the molecular formula C32H43N5O2 and a molecular weight of 529.73 g/mol. Its IUPAC name is 2-[N-decyl-4-[(2-methoxy-5-methyl-4-phenyldiazenylphenyl)diazenyl]anilino]ethanol.
| Compound Name | 2-[N-decyl-4-[(2-methoxy-5-methyl-4-phenyldiazenylphenyl)diazenyl]anilino]ethanol |
|---|---|
| PubChem CID | 135225069 |
| Molecular Formula | C32H43N5O2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | 2-[N-decyl-4-[(2-methoxy-5-methyl-4-phenyldiazenylphenyl)diazenyl]anilino]ethanol |
| SMILES | CCCCCCCCCCN(CCO)c1ccc(/N=N/c2cc(C)c(/N=N/c3ccccc3)cc2OC)cc1 |
| InChI | InChI=1S/C32H43N5O2/c1-4-5-6-7-8-9-10-14-21-37(22-23-38)29-19-17-28(18-20-29)34-36-31-24-26(2)30(25-32(31)39-3)35-33-27-15-12-11-13-16-27/h11-13,15-20,24-25,38H,4-10,14,21-23H2,1-3H3/b35-33+,36-34+ |
| InChIKey | JRXFMQPNZDNLMZ-LBYUQGKWSA-N |
| XLogP | 9.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|