C24H25N7O6 — CID 90378459
2-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-(2-nitrosoethyl)anilino]ethanol (PubChem CID 90378459) has the molecular formula C24H25N7O6 and a molecular weight of 507.51 g/mol. Its IUPAC name is 2-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-(2-nitrosoethyl)anilino]ethanol.
| Compound Name | 2-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-(2-nitrosoethyl)anilino]ethanol |
|---|---|
| PubChem CID | 90378459 |
| Molecular Formula | C24H25N7O6 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-(2-nitrosoethyl)anilino]ethanol |
| SMILES | COc1cc(/N=N/c2ccc([N+](=O)[O-])cc2)c(OC)cc1/N=N/c1ccc(N(CCO)CCN=O)cc1 |
| InChI | InChI=1S/C24H25N7O6/c1-36-23-16-22(29-27-18-5-9-20(10-6-18)31(34)35)24(37-2)15-21(23)28-26-17-3-7-19(8-4-17)30(13-14-32)12-11-25-33/h3-10,15-16,32H,11-14H2,1-2H3/b28-26+,29-27+ |
| InChIKey | REUIGVNMOBCVEJ-TUUFZWAFSA-N |
| XLogP | 6.01 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|