C20H17N5O4 — CID 156681842
[4-methoxy-2-[(4-nitrophenyl)diazenyl]-5-phenyldiazenylphenyl]methanol (PubChem CID 156681842) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is [4-methoxy-2-[(4-nitrophenyl)diazenyl]-5-phenyldiazenylphenyl]methanol.
| Compound Name | [4-methoxy-2-[(4-nitrophenyl)diazenyl]-5-phenyldiazenylphenyl]methanol |
|---|---|
| PubChem CID | 156681842 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [4-methoxy-2-[(4-nitrophenyl)diazenyl]-5-phenyldiazenylphenyl]methanol |
| SMILES | COc1cc(/N=N/c2ccc([N+](=O)[O-])cc2)c(CO)cc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C20H17N5O4/c1-29-20-12-18(23-22-16-7-9-17(10-8-16)25(27)28)14(13-26)11-19(20)24-21-15-5-3-2-4-6-15/h2-12,26H,13H2,1H3/b23-22+,24-21+ |
| InChIKey | BBKCHWAUGRDONM-MDNZCRNZSA-N |
| XLogP | 5.93 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|