C25H25F3N6O7S — CID 134222535
2-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl trifluoromethanesulfonate (PubChem CID 134222535) has the molecular formula C25H25F3N6O7S and a molecular weight of 610.57 g/mol. Its IUPAC name is 2-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl trifluoromethanesulfonate.
| Compound Name | 2-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134222535 |
| Molecular Formula | C25H25F3N6O7S |
| Molecular Weight | 610.57 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | 2-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl trifluoromethanesulfonate |
| SMILES | CCN(CCOS(=O)(=O)C(F)(F)F)c1ccc(/N=N/c2cc(OC)c(/N=N/c3ccc([N+](=O)[O-])cc3)cc2OC)cc1 |
| InChI | InChI=1S/C25H25F3N6O7S/c1-4-33(13-14-41-42(37,38)25(26,27)28)19-9-5-17(6-10-19)29-31-21-15-24(40-3)22(16-23(21)39-2)32-30-18-7-11-20(12-8-18)34(35)36/h5-12,15-16H,4,13-14H2,1-3H3/b31-29+,32-30+ |
| InChIKey | GPSRJEGPXQJRMJ-JWTBXLROSA-N |
| XLogP | 7.14 |
| TPSA | 157.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.57 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|