C30H31N7O8 — CID 59064813
(2,5-dioxopyrrolidin-1-yl) 4-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]butanoate (PubChem CID 59064813) has the molecular formula C30H31N7O8 and a molecular weight of 617.62 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]butanoate |
|---|---|
| PubChem CID | 59064813 |
| Molecular Formula | C30H31N7O8 |
| Molecular Weight | 617.62 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]butanoate |
| SMILES | CCN(CCCC(=O)ON1C(=O)CCC1=O)c1ccc(/N=N/c2cc(OC)c(/N=N/c3ccc([N+](=O)[O-])cc3)cc2OC)cc1 |
| InChI | InChI=1S/C30H31N7O8/c1-4-35(17-5-6-30(40)45-36-28(38)15-16-29(36)39)22-11-7-20(8-12-22)31-33-24-18-27(44-3)25(19-26(24)43-2)34-32-21-9-13-23(14-10-21)37(41)42/h7-14,18-19H,4-6,15-17H2,1-3H3/b33-31+,34-32+ |
| InChIKey | ASEYPGAJRXHVKO-FMWAKIAMSA-N |
| XLogP | 6.66 |
| TPSA | 177.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|