C33H42N7O7+ — CID 59064774
1-[2-(1-deuteriooxy-3-hydroxypropan-2-yl)pyrrolidin-1-ium-1-yl]-4-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]butan-1-one (PubChem CID 59064774) has the molecular formula C33H42N7O7+ and a molecular weight of 649.75 g/mol. Its IUPAC name is 1-[2-(1-deuteriooxy-3-hydroxypropan-2-yl)pyrrolidin-1-ium-1-yl]-4-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]butan-1-one.
| Compound Name | 1-[2-(1-deuteriooxy-3-hydroxypropan-2-yl)pyrrolidin-1-ium-1-yl]-4-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]butan-1-one |
|---|---|
| PubChem CID | 59064774 |
| Molecular Formula | C33H42N7O7+ |
| Molecular Weight | 649.75 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | 1-[2-(1-deuteriooxy-3-hydroxypropan-2-yl)pyrrolidin-1-ium-1-yl]-4-[4-[[2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]butan-1-one |
| SMILES | [2H]OCC(CO)C1CCC[NH+]1C(=O)CCCN(CC)c1ccc(/N=N/c2cc(OC)c(/N=N/c3ccc([N+](=O)[O-])cc3)cc2OC)cc1 |
| InChI | InChI=1S/C33H41N7O7/c1-4-38(17-6-8-33(43)39-18-5-7-30(39)23(21-41)22-42)26-13-9-24(10-14-26)34-36-28-19-32(47-3)29(20-31(28)46-2)37-35-25-11-15-27(16-12-25)40(44)45/h9-16,19-20,23,30,41-42H,4-8,17-18,21-22H2,1-3H3/p+1/b36-34+,37-35+/i41D |
| InChIKey | MSMNTTKNYUXVBV-HOAXQNFDSA-O |
| XLogP | 5.22 |
| TPSA | 176.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.75 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|