C20H23N5O8 — CID 59064802
4-[4-[(2,4-dinitrophenyl)diazenyl]-N-ethyl-2,5-dimethoxyanilino]butanoic acid (PubChem CID 59064802) has the molecular formula C20H23N5O8 and a molecular weight of 461.43 g/mol. Its IUPAC name is 4-[4-[(2,4-dinitrophenyl)diazenyl]-N-ethyl-2,5-dimethoxyanilino]butanoic acid.
| Compound Name | 4-[4-[(2,4-dinitrophenyl)diazenyl]-N-ethyl-2,5-dimethoxyanilino]butanoic acid |
|---|---|
| PubChem CID | 59064802 |
| Molecular Formula | C20H23N5O8 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 4-[4-[(2,4-dinitrophenyl)diazenyl]-N-ethyl-2,5-dimethoxyanilino]butanoic acid |
| SMILES | CCN(CCCC(=O)O)c1cc(OC)c(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H23N5O8/c1-4-23(9-5-6-20(26)27)17-12-18(32-2)15(11-19(17)33-3)22-21-14-8-7-13(24(28)29)10-16(14)25(30)31/h7-8,10-12H,4-6,9H2,1-3H3,(H,26,27)/b22-21+ |
| InChIKey | MTTPQRQXUFKTGE-QURGRASLSA-N |
| XLogP | 4.63 |
| TPSA | 170.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|