C23H27N5O6 — CID 58460675
ethyl 4-[4-[(2-cyano-4-nitrophenyl)diazenyl]-N-ethyl-5-(hydroxymethyl)-2-methoxyanilino]butanoate (PubChem CID 58460675) has the molecular formula C23H27N5O6 and a molecular weight of 469.50 g/mol. Its IUPAC name is ethyl 4-[4-[(2-cyano-4-nitrophenyl)diazenyl]-N-ethyl-5-(hydroxymethyl)-2-methoxyanilino]butanoate.
| Compound Name | ethyl 4-[4-[(2-cyano-4-nitrophenyl)diazenyl]-N-ethyl-5-(hydroxymethyl)-2-methoxyanilino]butanoate |
|---|---|
| PubChem CID | 58460675 |
| Molecular Formula | C23H27N5O6 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | ethyl 4-[4-[(2-cyano-4-nitrophenyl)diazenyl]-N-ethyl-5-(hydroxymethyl)-2-methoxyanilino]butanoate |
| SMILES | CCOC(=O)CCCN(CC)c1cc(CO)c(/N=N/c2ccc([N+](=O)[O-])cc2C#N)cc1OC |
| InChI | InChI=1S/C23H27N5O6/c1-4-27(10-6-7-23(30)34-5-2)21-12-17(15-29)20(13-22(21)33-3)26-25-19-9-8-18(28(31)32)11-16(19)14-24/h8-9,11-13,29H,4-7,10,15H2,1-3H3/b26-25+ |
| InChIKey | LODYOPLQUXPKCA-OCEACIFDSA-N |
| XLogP | 4.55 |
| TPSA | 150.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|