C22H21ClN6O8 — CID 170842542
methyl 2-[5-acetamido-4-[(2-chloro-6-cyano-4-nitrophenyl)diazenyl]-2-methoxy-N-(2-methoxy-2-oxoethyl)anilino]acetate (PubChem CID 170842542) has the molecular formula C22H21ClN6O8 and a molecular weight of 532.90 g/mol. Its IUPAC name is methyl 2-[5-acetamido-4-[(2-chloro-6-cyano-4-nitrophenyl)diazenyl]-2-methoxy-N-(2-methoxy-2-oxoethyl)anilino]acetate.
| Compound Name | methyl 2-[5-acetamido-4-[(2-chloro-6-cyano-4-nitrophenyl)diazenyl]-2-methoxy-N-(2-methoxy-2-oxoethyl)anilino]acetate |
|---|---|
| PubChem CID | 170842542 |
| Molecular Formula | C22H21ClN6O8 |
| Molecular Weight | 532.90 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | methyl 2-[5-acetamido-4-[(2-chloro-6-cyano-4-nitrophenyl)diazenyl]-2-methoxy-N-(2-methoxy-2-oxoethyl)anilino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)c1cc(NC(C)=O)c(/N=N/c2c(Cl)cc([N+](=O)[O-])cc2C#N)cc1OC |
| InChI | InChI=1S/C22H21ClN6O8/c1-12(30)25-16-7-18(28(10-20(31)36-3)11-21(32)37-4)19(35-2)8-17(16)26-27-22-13(9-24)5-14(29(33)34)6-15(22)23/h5-8H,10-11H2,1-4H3,(H,25,30)/b27-26+ |
| InChIKey | MNOJJJPQBDUVLE-CYYJNZCTSA-N |
| XLogP | 3.65 |
| TPSA | 185.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.90 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|