C24H25N7O10S — CID 155699051
methyl 3-[5-acetamido-4-[(2,4-dinitro-5-thiocyanatophenyl)diazenyl]-2-methoxy-N-(3-methoxy-3-oxopropyl)anilino]propanoate (PubChem CID 155699051) has the molecular formula C24H25N7O10S and a molecular weight of 603.57 g/mol. Its IUPAC name is methyl 3-[5-acetamido-4-[(2,4-dinitro-5-thiocyanatophenyl)diazenyl]-2-methoxy-N-(3-methoxy-3-oxopropyl)anilino]propanoate.
| Compound Name | methyl 3-[5-acetamido-4-[(2,4-dinitro-5-thiocyanatophenyl)diazenyl]-2-methoxy-N-(3-methoxy-3-oxopropyl)anilino]propanoate |
|---|---|
| PubChem CID | 155699051 |
| Molecular Formula | C24H25N7O10S |
| Molecular Weight | 603.57 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | methyl 3-[5-acetamido-4-[(2,4-dinitro-5-thiocyanatophenyl)diazenyl]-2-methoxy-N-(3-methoxy-3-oxopropyl)anilino]propanoate |
| SMILES | COC(=O)CCN(CCC(=O)OC)c1cc(NC(C)=O)c(/N=N/c2cc(SC#N)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C24H25N7O10S/c1-14(32)26-15-9-19(29(7-5-23(33)40-3)8-6-24(34)41-4)21(39-2)10-16(15)27-28-17-11-22(42-13-25)20(31(37)38)12-18(17)30(35)36/h9-12H,5-8H2,1-4H3,(H,26,32)/b28-27+ |
| InChIKey | YRFIMXMVGXPQMY-BYYHNAKLSA-N |
| XLogP | 4.39 |
| TPSA | 228.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|