C21H22N6O7 — CID 135772764
N-[5-[bis(prop-2-enyl)amino]-2-[(2-hydroxy-4,6-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide (PubChem CID 135772764) has the molecular formula C21H22N6O7 and a molecular weight of 470.44 g/mol. Its IUPAC name is N-[5-[bis(prop-2-enyl)amino]-2-[(2-hydroxy-4,6-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide.
| Compound Name | N-[5-[bis(prop-2-enyl)amino]-2-[(2-hydroxy-4,6-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 135772764 |
| Molecular Formula | C21H22N6O7 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-[5-[bis(prop-2-enyl)amino]-2-[(2-hydroxy-4,6-dinitrophenyl)diazenyl]-4-methoxyphenyl]acetamide |
| SMILES | C=CCN(CC=C)c1cc(NC(C)=O)c(/N=N/c2c(O)cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H22N6O7/c1-5-7-25(8-6-2)17-11-15(22-13(3)28)16(12-20(17)34-4)23-24-21-18(27(32)33)9-14(26(30)31)10-19(21)29/h5-6,9-12,29H,1-2,7-8H2,3-4H3,(H,22,28)/b24-23+ |
| InChIKey | ADGYSFWQQRCQIO-WCWDXBQESA-N |
| XLogP | 4.77 |
| TPSA | 172.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|