C19H19BrI2N4O4 — CID 91580029
N-[2-[(2-bromo-4-methyl-6-nitrophenyl)diazenyl]-4-methoxy-5-prop-2-enylphenyl]acetamide;molecular iodine (PubChem CID 91580029) has the molecular formula C19H19BrI2N4O4 and a molecular weight of 701.10 g/mol. Its IUPAC name is N-[2-[(2-bromo-4-methyl-6-nitrophenyl)diazenyl]-4-methoxy-5-prop-2-enylphenyl]acetamide;molecular iodine.
| Compound Name | N-[2-[(2-bromo-4-methyl-6-nitrophenyl)diazenyl]-4-methoxy-5-prop-2-enylphenyl]acetamide;molecular iodine |
|---|---|
| PubChem CID | 91580029 |
| Molecular Formula | C19H19BrI2N4O4 |
| Molecular Weight | 701.10 g/mol |
| Exact Mass | 699.87 |
| IUPAC Name | N-[2-[(2-bromo-4-methyl-6-nitrophenyl)diazenyl]-4-methoxy-5-prop-2-enylphenyl]acetamide;molecular iodine |
| SMILES | C=CCc1cc(NC(C)=O)c(/N=N/c2c(Br)cc(C)cc2[N+](=O)[O-])cc1OC.II |
| InChI | InChI=1S/C19H19BrN4O4.I2/c1-5-6-13-9-15(21-12(3)25)16(10-18(13)28-4)22-23-19-14(20)7-11(2)8-17(19)24(26)27;1-2/h5,7-10H,1,6H2,2-4H3,(H,21,25);/b23-22+; |
| InChIKey | IVYMIZVJGYCSOI-PGCQSHBKSA-N |
| XLogP | 7.55 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.10 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|