C19H19FN6O8 — CID 155148661
methyl 3-[5-acetamido-4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate (PubChem CID 155148661) has the molecular formula C19H19FN6O8 and a molecular weight of 478.39 g/mol. Its IUPAC name is methyl 3-[5-acetamido-4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate.
| Compound Name | methyl 3-[5-acetamido-4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate |
|---|---|
| PubChem CID | 155148661 |
| Molecular Formula | C19H19FN6O8 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | methyl 3-[5-acetamido-4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate |
| SMILES | COC(=O)CCNc1cc(NC(C)=O)c(/N=N/c2cc(F)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H19FN6O8/c1-10(27)22-12-7-15(21-5-4-19(28)34-3)18(33-2)8-13(12)23-24-14-6-11(20)16(25(29)30)9-17(14)26(31)32/h6-9,21H,4-5H2,1-3H3,(H,22,27)/b24-23+ |
| InChIKey | KEBCEJZTVWFUQV-WCWDXBQESA-N |
| XLogP | 4.00 |
| TPSA | 187.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|