C25H27N7O8S — CID 164959642
2-methylprop-2-enyl 3-[5-acetamido-N-ethyl-4-[(5-isocyanosulfanyl-2,4-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate (PubChem CID 164959642) has the molecular formula C25H27N7O8S and a molecular weight of 585.60 g/mol. Its IUPAC name is 2-methylprop-2-enyl 3-[5-acetamido-N-ethyl-4-[(5-isocyanosulfanyl-2,4-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate.
| Compound Name | 2-methylprop-2-enyl 3-[5-acetamido-N-ethyl-4-[(5-isocyanosulfanyl-2,4-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate |
|---|---|
| PubChem CID | 164959642 |
| Molecular Formula | C25H27N7O8S |
| Molecular Weight | 585.60 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | 2-methylprop-2-enyl 3-[5-acetamido-N-ethyl-4-[(5-isocyanosulfanyl-2,4-dinitrophenyl)diazenyl]-2-methoxyanilino]propanoate |
| SMILES | [C-]#[N+]Sc1cc(/N=N/c2cc(OC)c(N(CC)CCC(=O)OCC(=C)C)cc2NC(C)=O)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H27N7O8S/c1-7-30(9-8-25(34)40-14-15(2)3)21-10-17(27-16(4)33)18(11-23(21)39-6)28-29-19-12-24(41-26-5)22(32(37)38)13-20(19)31(35)36/h10-13H,2,7-9,14H2,1,3-4,6H3,(H,27,33)/b29-28+ |
| InChIKey | CYFPQNIRQUKOEV-ZQHSETAFSA-N |
| XLogP | 6.15 |
| TPSA | 183.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|