C19H19BrClN5O5 — CID 164979565
methyl 2-[3-acetamido-4-[(2-bromo-6-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate (PubChem CID 164979565) has the molecular formula C19H19BrClN5O5 and a molecular weight of 512.75 g/mol. Its IUPAC name is methyl 2-[3-acetamido-4-[(2-bromo-6-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate.
| Compound Name | methyl 2-[3-acetamido-4-[(2-bromo-6-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate |
|---|---|
| PubChem CID | 164979565 |
| Molecular Formula | C19H19BrClN5O5 |
| Molecular Weight | 512.75 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | methyl 2-[3-acetamido-4-[(2-bromo-6-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]acetate |
| SMILES | CCN(CC(=O)OC)c1ccc(/N=N/c2c(Cl)cc([N+](=O)[O-])cc2Br)c(NC(C)=O)c1 |
| InChI | InChI=1S/C19H19BrClN5O5/c1-4-25(10-18(28)31-3)12-5-6-16(17(9-12)22-11(2)27)23-24-19-14(20)7-13(26(29)30)8-15(19)21/h5-9H,4,10H2,1-3H3,(H,22,27)/b24-23+ |
| InChIKey | AGLXAAIVXAWZIR-WCWDXBQESA-N |
| XLogP | 5.38 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.75 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|