C21H22BrClN4O4 — CID 58535875
2-[4-[(2-bromo-6-chloro-4-nitrophenyl)diazenyl]-N-ethyl-3-methylanilino]ethyl 2-methylprop-2-enoate (PubChem CID 58535875) has the molecular formula C21H22BrClN4O4 and a molecular weight of 509.79 g/mol. Its IUPAC name is 2-[4-[(2-bromo-6-chloro-4-nitrophenyl)diazenyl]-N-ethyl-3-methylanilino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[(2-bromo-6-chloro-4-nitrophenyl)diazenyl]-N-ethyl-3-methylanilino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58535875 |
| Molecular Formula | C21H22BrClN4O4 |
| Molecular Weight | 509.79 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 2-[4-[(2-bromo-6-chloro-4-nitrophenyl)diazenyl]-N-ethyl-3-methylanilino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(CC)c1ccc(/N=N/c2c(Cl)cc([N+](=O)[O-])cc2Br)c(C)c1 |
| InChI | InChI=1S/C21H22BrClN4O4/c1-5-26(8-9-31-21(28)13(2)3)15-6-7-19(14(4)10-15)24-25-20-17(22)11-16(27(29)30)12-18(20)23/h6-7,10-12H,2,5,8-9H2,1,3-4H3/b25-24+ |
| InChIKey | UMTHFVCIIKPCSC-OCOZRVBESA-N |
| XLogP | 6.68 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.79 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|