C21H21ClN4O2 — CID 102472654
2-[4-[(3-chloro-4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl 2-methylprop-2-enoate (PubChem CID 102472654) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 2-[4-[(3-chloro-4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[(3-chloro-4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102472654 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-[4-[(3-chloro-4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(CC)c1ccc(/N=N/c2ccc(C#N)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H21ClN4O2/c1-4-26(11-12-28-21(27)15(2)3)19-9-7-17(8-10-19)24-25-18-6-5-16(14-23)20(22)13-18/h5-10,13H,2,4,11-12H2,1,3H3/b25-24+ |
| InChIKey | OXQTYOIVAFQIRY-OCOZRVBESA-N |
| XLogP | 5.57 |
| TPSA | 78.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|