C23H28N4O2 — CID 59824310
2-[4-[(4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl 2,2-dimethylbutanoate (PubChem CID 59824310) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[4-[(4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[4-[(4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59824310 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[4-[(4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl 2,2-dimethylbutanoate |
| SMILES | CCN(CCOC(=O)C(C)(C)CC)c1ccc(/N=N/c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C23H28N4O2/c1-5-23(3,4)22(28)29-16-15-27(6-2)21-13-11-20(12-14-21)26-25-19-9-7-18(17-24)8-10-19/h7-14H,5-6,15-16H2,1-4H3/b26-25+ |
| InChIKey | FFONPTLDONYXEE-OCEACIFDSA-N |
| XLogP | 5.78 |
| TPSA | 78.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|