C31H40N6O4 — CID 58814555
2-[4-[[4-[[4-[bis(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate (PubChem CID 58814555) has the molecular formula C31H40N6O4 and a molecular weight of 560.70 g/mol. Its IUPAC name is 2-[4-[[4-[[4-[bis(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[4-[[4-[[4-[bis(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58814555 |
| Molecular Formula | C31H40N6O4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | 2-[4-[[4-[[4-[bis(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCN(C)c1ccc(/N=N/c2ccc(/N=N/c3ccc(N(CCO)CCO)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H40N6O4/c1-5-31(2,3)30(40)41-23-20-36(4)28-14-10-26(11-15-28)34-32-24-6-8-25(9-7-24)33-35-27-12-16-29(17-13-27)37(18-21-38)19-22-39/h6-17,38-39H,5,18-23H2,1-4H3/b34-32+,35-33+ |
| InChIKey | NWCJINNMZVAFTA-XUXOKTBYSA-N |
| XLogP | 6.72 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|