C38H53N3O4 — CID 158943234
1-O-[2-[4-[1,1-bis[4-(dimethylamino)phenyl]ethyl]-N-methylanilino]ethyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 158943234) has the molecular formula C38H53N3O4 and a molecular weight of 615.86 g/mol. Its IUPAC name is 1-O-[2-[4-[1,1-bis[4-(dimethylamino)phenyl]ethyl]-N-methylanilino]ethyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-[2-[4-[1,1-bis[4-(dimethylamino)phenyl]ethyl]-N-methylanilino]ethyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 158943234 |
| Molecular Formula | C38H53N3O4 |
| Molecular Weight | 615.86 g/mol |
| Exact Mass | 615.40 |
| IUPAC Name | 1-O-[2-[4-[1,1-bis[4-(dimethylamino)phenyl]ethyl]-N-methylanilino]ethyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCN(C)c1ccc(C(C)(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1)C(=O)OC |
| InChI | InChI=1S/C38H53N3O4/c1-12-37(4,35(43)44-11)27-36(2,3)34(42)45-26-25-41(10)33-23-17-30(18-24-33)38(5,28-13-19-31(20-14-28)39(6)7)29-15-21-32(22-16-29)40(8)9/h13-24H,12,25-27H2,1-11H3 |
| InChIKey | VOPMGWNLZHGPJG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.86 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|