C15H26O4 — CID 58112337
1-O-but-3-enyl 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 58112337) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-O-but-3-enyl 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-but-3-enyl 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 58112337 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-O-but-3-enyl 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | C=CCCOC(=O)C(C)(C)CC(C)(CC)C(=O)OC |
| InChI | InChI=1S/C15H26O4/c1-7-9-10-19-12(16)14(3,4)11-15(5,8-2)13(17)18-6/h7H,1,8-11H2,2-6H3 |
| InChIKey | AWSWSAFPLICVJX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|