C17H30O6 — CID 59972134
trimethyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 59972134) has the molecular formula C17H30O6 and a molecular weight of 330.42 g/mol. Its IUPAC name is trimethyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | trimethyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59972134 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | trimethyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H30O6/c1-9-16(4,13(19)22-7)11-17(5,14(20)23-8)10-15(2,3)12(18)21-6/h9-11H2,1-8H3 |
| InChIKey | NSTKPHMTLIVCQE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|