C17H38O7Si — CID 159055104
methane;1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 159055104) has the molecular formula C17H38O7Si and a molecular weight of 382.57 g/mol. Its IUPAC name is methane;1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | methane;1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 159055104 |
| Molecular Formula | C17H38O7Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | methane;1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | C.C.CCC(C)(CC(C)(C)C(=O)OC[Si](OC)(OC)OC)C(=O)OC |
| InChI | InChI=1S/C15H30O7Si.2CH4/c1-9-15(4,13(17)18-5)10-14(2,3)12(16)22-11-23(19-6,20-7)21-8;;/h9-11H2,1-8H3;2*1H4 |
| InChIKey | JXTISBPKXOJGAG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|