C72H126O20 — CID 130232997
decapropan-2-yl 1,1,3,5,7,9,11,13,15,17,19-undecamethylhenicosane-1,3,5,7,9,11,13,15,17,19-decacarboxylate (PubChem CID 130232997) has the molecular formula C72H126O20 and a molecular weight of 1311.78 g/mol. Its IUPAC name is decapropan-2-yl 1,1,3,5,7,9,11,13,15,17,19-undecamethylhenicosane-1,3,5,7,9,11,13,15,17,19-decacarboxylate.
| Compound Name | decapropan-2-yl 1,1,3,5,7,9,11,13,15,17,19-undecamethylhenicosane-1,3,5,7,9,11,13,15,17,19-decacarboxylate |
|---|---|
| PubChem CID | 130232997 |
| Molecular Formula | C72H126O20 |
| Molecular Weight | 1311.78 g/mol |
| Exact Mass | 1310.88 |
| IUPAC Name | decapropan-2-yl 1,1,3,5,7,9,11,13,15,17,19-undecamethylhenicosane-1,3,5,7,9,11,13,15,17,19-decacarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)(CC(C)(CC(C)(CC(C)(CC(C)(CC(C)(CC(C)(C)C(=O)OC(C)C)C(=O)OC(C)C)C(=O)OC(C)C)C(=O)OC(C)C)C(=O)OC(C)C)C(=O)OC(C)C)C(=O)OC(C)C)C(=O)OC(C)C)C(=O)OC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C72H126O20/c1-33-64(24,54(74)84-44(4)5)35-66(26,56(76)86-46(8)9)37-68(28,58(78)88-48(12)13)39-70(30,60(80)90-50(16)17)41-72(32,62(82)92-52(20)21)42-71(31,61(81)91-51(18)19)40-69(29,59(79)89-49(14)15)38-67(27,57(77)87-47(10)11)36-65(25,55(75)85-45(6)7)34-63(22,23)53(73)83-43(2)3/h43-52H,33-42H2,1-32H3 |
| InChIKey | ZTLZQDICDHAYHK-UHFFFAOYSA-N |
| XLogP | 14.51 |
| TPSA | 263.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1311.78 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|