C47H76O10 — CID 66603061
pentacyclopentyl 1,1,3,5,7,9-hexamethylundecane-1,3,5,7,9-pentacarboxylate (PubChem CID 66603061) has the molecular formula C47H76O10 and a molecular weight of 801.11 g/mol. Its IUPAC name is pentacyclopentyl 1,1,3,5,7,9-hexamethylundecane-1,3,5,7,9-pentacarboxylate.
| Compound Name | pentacyclopentyl 1,1,3,5,7,9-hexamethylundecane-1,3,5,7,9-pentacarboxylate |
|---|---|
| PubChem CID | 66603061 |
| Molecular Formula | C47H76O10 |
| Molecular Weight | 801.11 g/mol |
| Exact Mass | 800.54 |
| IUPAC Name | pentacyclopentyl 1,1,3,5,7,9-hexamethylundecane-1,3,5,7,9-pentacarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)(CC(C)(C)C(=O)OC1CCCC1)C(=O)OC1CCCC1)C(=O)OC1CCCC1)C(=O)OC1CCCC1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C47H76O10/c1-8-44(4,39(49)54-34-21-11-12-22-34)30-46(6,41(51)56-36-25-15-16-26-36)32-47(7,42(52)57-37-27-17-18-28-37)31-45(5,40(50)55-35-23-13-14-24-35)29-43(2,3)38(48)53-33-19-9-10-20-33/h33-37H,8-32H2,1-7H3 |
| InChIKey | WKQDPYSBTQWAEE-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.11 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|