C26H45NO6 — CID 129189349
1-O-(1-butoxycarbonylpiperidin-4-yl) 5-O-cyclohexyl 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 129189349) has the molecular formula C26H45NO6 and a molecular weight of 467.65 g/mol. Its IUPAC name is 1-O-(1-butoxycarbonylpiperidin-4-yl) 5-O-cyclohexyl 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-(1-butoxycarbonylpiperidin-4-yl) 5-O-cyclohexyl 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 129189349 |
| Molecular Formula | C26H45NO6 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.32 |
| IUPAC Name | 1-O-(1-butoxycarbonylpiperidin-4-yl) 5-O-cyclohexyl 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCCCOC(=O)N1CCC(OC(=O)C(C)(C)CC(C)(CC)C(=O)OC2CCCCC2)CC1 |
| InChI | InChI=1S/C26H45NO6/c1-6-8-18-31-24(30)27-16-14-21(15-17-27)32-22(28)25(3,4)19-26(5,7-2)23(29)33-20-12-10-9-11-13-20/h20-21H,6-19H2,1-5H3 |
| InChIKey | MRDWKYDHUTUNRZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|