C13H21F3O2 — CID 59422991
cycloheptyl 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 59422991) has the molecular formula C13H21F3O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is cycloheptyl 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | cycloheptyl 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 59422991 |
| Molecular Formula | C13H21F3O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | cycloheptyl 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC1CCCCCC1)C(F)(F)F |
| InChI | InChI=1S/C13H21F3O2/c1-3-12(2,13(14,15)16)11(17)18-10-8-6-4-5-7-9-10/h10H,3-9H2,1-2H3 |
| InChIKey | HWYXBXHKRNQERM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |