C20H27F15O3 — CID 161095704
[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate;methane (PubChem CID 161095704) has the molecular formula C20H27F15O3 and a molecular weight of 600.40 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate;methane.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate;methane |
|---|---|
| PubChem CID | 161095704 |
| Molecular Formula | C20H27F15O3 |
| Molecular Weight | 600.40 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate;methane |
| SMILES | C.C.CCC(C)(C(=O)OC(C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H19F15O3.2CH4/c1-3-11(2,14(19,20)21)10(34)36-13(17(28,29)30,18(31,32)33)9-6-4-8(5-7-9)12(35,15(22,23)24)16(25,26)27;;/h8-9,35H,3-7H2,1-2H3;2*1H4 |
| InChIKey | UHTLYXXPUWPYPX-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.40 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |