C29H33F17O3 — CID 90895703
[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2,2-dimethylbutanoate;1,2,3,4,5-pentafluoro-6-(2-methylbutan-2-yl)benzene (PubChem CID 90895703) has the molecular formula C29H33F17O3 and a molecular weight of 752.55 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2,2-dimethylbutanoate;1,2,3,4,5-pentafluoro-6-(2-methylbutan-2-yl)benzene.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2,2-dimethylbutanoate;1,2,3,4,5-pentafluoro-6-(2-methylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 90895703 |
| Molecular Formula | C29H33F17O3 |
| Molecular Weight | 752.55 g/mol |
| Exact Mass | 752.22 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2,2-dimethylbutanoate;1,2,3,4,5-pentafluoro-6-(2-methylbutan-2-yl)benzene |
| SMILES | CCC(C)(C)C(=O)OC(C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F.CCC(C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H22F12O3.C11H11F5/c1-4-12(2,3)11(31)33-14(17(25,26)27,18(28,29)30)10-7-5-9(6-8-10)13(32,15(19,20)21)16(22,23)24;1-4-11(2,3)5-6(12)8(14)10(16)9(15)7(5)13/h9-10,32H,4-8H2,1-3H3;4H2,1-3H3 |
| InChIKey | OSNHOXUNDNYQJR-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.55 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|