C18H25F9O5 — CID 58455658
[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxy-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate (PubChem CID 58455658) has the molecular formula C18H25F9O5 and a molecular weight of 492.38 g/mol. Its IUPAC name is [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxy-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate.
| Compound Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxy-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58455658 |
| Molecular Formula | C18H25F9O5 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxy-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C(C)(O)C(F)(F)F)C(O)C(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C18H25F9O5/c1-5-13(2,3)12(29)32-8-6-9(14(4,30)16(19,20)21)11(28)10(7-8)15(31,17(22,23)24)18(25,26)27/h8-11,28,30-31H,5-7H2,1-4H3 |
| InChIKey | IFELQNXBHUSDMY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |