C31H50F6O7 — CID 160768735
[3,5-bis(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;(6-hydroxy-2-bicyclo[2.2.1]heptanyl) 2,2-dimethylbutanoate (PubChem CID 160768735) has the molecular formula C31H50F6O7 and a molecular weight of 648.72 g/mol. Its IUPAC name is [3,5-bis(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;(6-hydroxy-2-bicyclo[2.2.1]heptanyl) 2,2-dimethylbutanoate.
| Compound Name | [3,5-bis(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;(6-hydroxy-2-bicyclo[2.2.1]heptanyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 160768735 |
| Molecular Formula | C31H50F6O7 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | [3,5-bis(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;(6-hydroxy-2-bicyclo[2.2.1]heptanyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C(C)(O)C(F)(F)F)CC(C(C)(O)C(F)(F)F)C1.CCC(C)(C)C(=O)OC1CC2CC(O)C1C2 |
| InChI | InChI=1S/C18H28F6O4.C13H22O3/c1-6-14(2,3)13(25)28-12-8-10(15(4,26)17(19,20)21)7-11(9-12)16(5,27)18(22,23)24;1-4-13(2,3)12(15)16-11-7-8-5-9(11)10(14)6-8/h10-12,26-27H,6-9H2,1-5H3;8-11,14H,4-7H2,1-3H3 |
| InChIKey | RZAMCECABXABOA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |