C15H21F4O5S- — CID 58391666
2-[6-(2,2-dimethylbutanoyloxy)-2-bicyclo[2.2.1]heptanyl]-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 58391666) has the molecular formula C15H21F4O5S- and a molecular weight of 389.39 g/mol. Its IUPAC name is 2-[6-(2,2-dimethylbutanoyloxy)-2-bicyclo[2.2.1]heptanyl]-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 2-[6-(2,2-dimethylbutanoyloxy)-2-bicyclo[2.2.1]heptanyl]-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 58391666 |
| Molecular Formula | C15H21F4O5S- |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-[6-(2,2-dimethylbutanoyloxy)-2-bicyclo[2.2.1]heptanyl]-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CCC(C)(C)C(=O)OC1CC2CC1C(C(F)(F)C(F)(F)S(=O)(=O)[O-])C2 |
| InChI | InChI=1S/C15H22F4O5S/c1-4-13(2,3)12(20)24-11-7-8-5-9(11)10(6-8)14(16,17)15(18,19)25(21,22)23/h8-11H,4-7H2,1-3H3,(H,21,22,23)/p-1 |
| InChIKey | STUASMJPOZIWSF-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|