C25H36F14O4 — CID 91288338
fluoroethane;[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;2,2,3,3-tetrafluoro-5-methyl-1-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 91288338) has the molecular formula C25H36F14O4 and a molecular weight of 666.53 g/mol. Its IUPAC name is fluoroethane;[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;2,2,3,3-tetrafluoro-5-methyl-1-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | fluoroethane;[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;2,2,3,3-tetrafluoro-5-methyl-1-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 91288338 |
| Molecular Formula | C25H36F14O4 |
| Molecular Weight | 666.53 g/mol |
| Exact Mass | 666.24 |
| IUPAC Name | fluoroethane;[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;2,2,3,3-tetrafluoro-5-methyl-1-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | CC1CC(F)(F)C(F)(F)C(O)(C(F)(F)F)C1.CCC(C)(C)C(=O)OC1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1.CCF |
| InChI | InChI=1S/C15H22F6O3.C8H9F7O.C2H5F/c1-4-12(2,3)11(22)24-10-7-5-9(6-8-10)13(23,14(16,17)18)15(19,20)21;1-4-2-5(16,8(13,14)15)7(11,12)6(9,10)3-4;1-2-3/h9-10,23H,4-8H2,1-3H3;4,16H,2-3H2,1H3;2H2,1H3 |
| InChIKey | IKKGBXKYJIUBGF-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.53 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|