About [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate
[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate (PubChem CID 162610369) has the molecular formula C13H18F6O3
and a molecular weight of 336.27 g/mol. Its IUPAC name is [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate |
| PubChem CID | 162610369 |
| Molecular Formula | C13H18F6O3 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1OC(C(F)(F)F)(C(F)(F)F)CC1C |
| InChI | InChI=1S/C13H18F6O3/c1-5-10(3,4)9(20)21-8-7(2)6-11(22-8,12(14,15)16)13(17,18)19/h7-8H,5-6H2,1-4H3 |
| InChIKey | VKSWTVPZKVCORW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate?
The IUPAC name of [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate (CID 162610369) is [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate.
What is the SMILES notation for [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate?
The canonical SMILES for [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC1OC(C(F)(F)F)(C(F)(F)F)CC1C.
What is the InChIKey of [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate?
The InChIKey is VKSWTVPZKVCORW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F6O3/c1-5-10(3,4)9(20)21-8-7(2)6-11(22-8,12(14,15)16)13(17,18)19/h7-8H,5-6H2,1-4H3.
What are the key properties of [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate?
[3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate has a molecular weight of 336.27 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate is sourced from PubChem (CID 162610369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).