C12H17NO4 — CID 59815491
(4-isocyano-3-methyl-5-oxooxolan-2-yl) 2,2-dimethylbutanoate (PubChem CID 59815491) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is (4-isocyano-3-methyl-5-oxooxolan-2-yl) 2,2-dimethylbutanoate.
| Compound Name | (4-isocyano-3-methyl-5-oxooxolan-2-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59815491 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (4-isocyano-3-methyl-5-oxooxolan-2-yl) 2,2-dimethylbutanoate |
| SMILES | [C-]#[N+]C1C(=O)OC(OC(=O)C(C)(C)CC)C1C |
| InChI | InChI=1S/C12H17NO4/c1-6-12(3,4)11(15)17-10-7(2)8(13-5)9(14)16-10/h7-8,10H,6H2,1-4H3 |
| InChIKey | ZCFBJYBDXPMWIY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|